C28H29N7OS — CID 118139005
2-tert-butyl-N-[6-[6-(1-methylpyrazol-4-yl)-5H-pyrrolo[3,2-d]pyrimidin-4-yl]-1,2,3,4-tetrahydronaphthalen-1-yl]-1,3-thiazole-5-carboxamide (PubChem CID 118139005) has the molecular formula C28H29N7OS and a molecular weight of 511.66 g/mol. Its IUPAC name is 2-tert-butyl-N-[6-[6-(1-methylpyrazol-4-yl)-5H-pyrrolo[3,2-d]pyrimidin-4-yl]-1,2,3,4-tetrahydronaphthalen-1-yl]-1,3-thiazole-5-carboxamide.
| Compound Name | 2-tert-butyl-N-[6-[6-(1-methylpyrazol-4-yl)-5H-pyrrolo[3,2-d]pyrimidin-4-yl]-1,2,3,4-tetrahydronaphthalen-1-yl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 118139005 |
| Molecular Formula | C28H29N7OS |
| Molecular Weight | 511.66 g/mol |
| Exact Mass | 511.22 |
| IUPAC Name | 2-tert-butyl-N-[6-[6-(1-methylpyrazol-4-yl)-5H-pyrrolo[3,2-d]pyrimidin-4-yl]-1,2,3,4-tetrahydronaphthalen-1-yl]-1,3-thiazole-5-carboxamide |
| SMILES | Cn1cc(-c2cc3ncnc(-c4ccc5c(c4)CCCC5NC(=O)c4cnc(C(C)(C)C)s4)c3[nH]2)cn1 |
| InChI | InChI=1S/C28H29N7OS/c1-28(2,3)27-29-13-23(37-27)26(36)34-20-7-5-6-16-10-17(8-9-19(16)20)24-25-22(30-15-31-24)11-21(33-25)18-12-32-35(4)14-18/h8-15,20,33H,5-7H2,1-4H3,(H,34,36) |
| InChIKey | AUFOFHWXVXFOIB-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.66 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |