C41H40N4O5 — CID 11814401
7-[(3aS,4S,6R,6aR)-2,2-dimethyl-6-(trityloxymethyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-5-(phenylmethoxymethyl)pyrrolo[3,2-d]pyrimidin-4-amine (PubChem CID 11814401) has the molecular formula C41H40N4O5 and a molecular weight of 668.79 g/mol. Its IUPAC name is 7-[(3aS,4S,6R,6aR)-2,2-dimethyl-6-(trityloxymethyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-5-(phenylmethoxymethyl)pyrrolo[3,2-d]pyrimidin-4-amine.
| Compound Name | 7-[(3aS,4S,6R,6aR)-2,2-dimethyl-6-(trityloxymethyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-5-(phenylmethoxymethyl)pyrrolo[3,2-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 11814401 |
| Molecular Formula | C41H40N4O5 |
| Molecular Weight | 668.79 g/mol |
| Exact Mass | 668.30 |
| IUPAC Name | 7-[(3aS,4S,6R,6aR)-2,2-dimethyl-6-(trityloxymethyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-5-(phenylmethoxymethyl)pyrrolo[3,2-d]pyrimidin-4-amine |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](COC(c1ccccc1)(c1ccccc1)c1ccccc1)O[C@H]2c1cn(COCc2ccccc2)c2c(N)ncnc12 |
| InChI | InChI=1S/C41H40N4O5/c1-40(2)49-37-33(25-47-41(29-17-9-4-10-18-29,30-19-11-5-12-20-30)31-21-13-6-14-22-31)48-36(38(37)50-40)32-23-45(35-34(32)43-26-44-39(35)42)27-46-24-28-15-7-3-8-16-28/h3-23,26,33,36-38H,24-25,27H2,1-2H3,(H2,42,43,44)/t33-,36+,37-,38+/m1/s1 |
| InChIKey | FWHOGHPQGOTQAJ-FJWQMDKSSA-N |
| XLogP | 7.16 |
| TPSA | 102.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.79 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|