About 3-deuterio-4,5,6,7-tetrahydro-1-benzothiophen-2-amine
3-deuterio-4,5,6,7-tetrahydro-1-benzothiophen-2-amine (PubChem CID 118151137) has the molecular formula C8H11NS
and a molecular weight of 154.26 g/mol. Its IUPAC name is 3-deuterio-4,5,6,7-tetrahydro-1-benzothiophen-2-amine.
Analyze 3-deuterio-4,5,6,7-tetrahydro-1-benzothiophen-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-deuterio-4,5,6,7-tetrahydro-1-benzothiophen-2-amine?
The IUPAC name of 3-deuterio-4,5,6,7-tetrahydro-1-benzothiophen-2-amine (CID 118151137) is 3-deuterio-4,5,6,7-tetrahydro-1-benzothiophen-2-amine.
What is the SMILES notation for 3-deuterio-4,5,6,7-tetrahydro-1-benzothiophen-2-amine?
The canonical SMILES for 3-deuterio-4,5,6,7-tetrahydro-1-benzothiophen-2-amine is [2H]c1c(N)sc2c1CCCC2.
What is the InChIKey of 3-deuterio-4,5,6,7-tetrahydro-1-benzothiophen-2-amine?
The InChIKey is FTGVDKSMUBJBME-UICOGKGYSA-N. The full InChI is InChI=1S/C8H11NS/c9-8-5-6-3-1-2-4-7(6)10-8/h5H,1-4,9H2/i5D.
What are the key properties of 3-deuterio-4,5,6,7-tetrahydro-1-benzothiophen-2-amine?
3-deuterio-4,5,6,7-tetrahydro-1-benzothiophen-2-amine has a molecular weight of 154.26 g/mol, XLogP of 2.21, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-deuterio-4,5,6,7-tetrahydro-1-benzothiophen-2-amine is sourced from PubChem (CID 118151137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).