C17H17ClN4O3 — CID 118155386
6-chloro-8-[2-hydroxyethyl-[(4-methoxyphenyl)methyl]amino]imidazo[1,2-b]pyridazine-3-carbaldehyde (PubChem CID 118155386) has the molecular formula C17H17ClN4O3 and a molecular weight of 360.80 g/mol. Its IUPAC name is 6-chloro-8-[2-hydroxyethyl-[(4-methoxyphenyl)methyl]amino]imidazo[1,2-b]pyridazine-3-carbaldehyde.
| Compound Name | 6-chloro-8-[2-hydroxyethyl-[(4-methoxyphenyl)methyl]amino]imidazo[1,2-b]pyridazine-3-carbaldehyde |
|---|---|
| PubChem CID | 118155386 |
| Molecular Formula | C17H17ClN4O3 |
| Molecular Weight | 360.80 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | 6-chloro-8-[2-hydroxyethyl-[(4-methoxyphenyl)methyl]amino]imidazo[1,2-b]pyridazine-3-carbaldehyde |
| SMILES | COc1ccc(CN(CCO)c2cc(Cl)nn3c(C=O)cnc23)cc1 |
| InChI | InChI=1S/C17H17ClN4O3/c1-25-14-4-2-12(3-5-14)10-21(6-7-23)15-8-16(18)20-22-13(11-24)9-19-17(15)22/h2-5,8-9,11,23H,6-7,10H2,1H3 |
| InChIKey | NZNFYOLGICSPAQ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 79.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.80 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|