C17H13ClF3N5O — CID 140943124
6-chloro-3-isocyano-N-[(4-methoxyphenyl)methyl]-N-(2,2,2-trifluoroethyl)imidazo[1,2-b]pyridazin-8-amine (PubChem CID 140943124) has the molecular formula C17H13ClF3N5O and a molecular weight of 395.77 g/mol. Its IUPAC name is 6-chloro-3-isocyano-N-[(4-methoxyphenyl)methyl]-N-(2,2,2-trifluoroethyl)imidazo[1,2-b]pyridazin-8-amine.
| Compound Name | 6-chloro-3-isocyano-N-[(4-methoxyphenyl)methyl]-N-(2,2,2-trifluoroethyl)imidazo[1,2-b]pyridazin-8-amine |
|---|---|
| PubChem CID | 140943124 |
| Molecular Formula | C17H13ClF3N5O |
| Molecular Weight | 395.77 g/mol |
| Exact Mass | 395.08 |
| IUPAC Name | 6-chloro-3-isocyano-N-[(4-methoxyphenyl)methyl]-N-(2,2,2-trifluoroethyl)imidazo[1,2-b]pyridazin-8-amine |
| SMILES | [C-]#[N+]c1cnc2c(N(Cc3ccc(OC)cc3)CC(F)(F)F)cc(Cl)nn12 |
| InChI | InChI=1S/C17H13ClF3N5O/c1-22-15-8-23-16-13(7-14(18)24-26(15)16)25(10-17(19,20)21)9-11-3-5-12(27-2)6-4-11/h3-8H,9-10H2,2H3 |
| InChIKey | FSMFVPAIPPASIR-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 47.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.77 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|