C21H20ClN5O2 — CID 118159450
[5-[(3-chlorophenyl)methyl]-12-methyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-4-yl]-morpholin-4-ylmethanone (PubChem CID 118159450) has the molecular formula C21H20ClN5O2 and a molecular weight of 409.88 g/mol. Its IUPAC name is [5-[(3-chlorophenyl)methyl]-12-methyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-4-yl]-morpholin-4-ylmethanone.
| Compound Name | [5-[(3-chlorophenyl)methyl]-12-methyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-4-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 118159450 |
| Molecular Formula | C21H20ClN5O2 |
| Molecular Weight | 409.88 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | [5-[(3-chlorophenyl)methyl]-12-methyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-4-yl]-morpholin-4-ylmethanone |
| SMILES | Cc1nnc2ccc3c(cc(C(=O)N4CCOCC4)n3Cc3cccc(Cl)c3)n12 |
| InChI | InChI=1S/C21H20ClN5O2/c1-14-23-24-20-6-5-17-18(27(14)20)12-19(21(28)25-7-9-29-10-8-25)26(17)13-15-3-2-4-16(22)11-15/h2-6,11-12H,7-10,13H2,1H3 |
| InChIKey | IPZSBZYKJVMWGL-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 64.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.88 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |