C22H22ClN7 — CID 123442224
N'-(azetidin-3-yl)-1-[5-[(3-chlorophenyl)methyl]-12-methyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-4-yl]propane-1,3-diimine (PubChem CID 123442224) has the molecular formula C22H22ClN7 and a molecular weight of 419.92 g/mol. Its IUPAC name is N'-(azetidin-3-yl)-1-[5-[(3-chlorophenyl)methyl]-12-methyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-4-yl]propane-1,3-diimine.
| Compound Name | N'-(azetidin-3-yl)-1-[5-[(3-chlorophenyl)methyl]-12-methyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-4-yl]propane-1,3-diimine |
|---|---|
| PubChem CID | 123442224 |
| Molecular Formula | C22H22ClN7 |
| Molecular Weight | 419.92 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | N'-(azetidin-3-yl)-1-[5-[(3-chlorophenyl)methyl]-12-methyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-4-yl]propane-1,3-diimine |
| SMILES | [H]/N=C(\C/C=N/C1CNC1)c1cc2c(ccc3nnc(C)n32)n1Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C22H22ClN7/c1-14-27-28-22-6-5-19-21(30(14)22)10-20(18(24)7-8-26-17-11-25-12-17)29(19)13-15-3-2-4-16(23)9-15/h2-6,8-10,17,24-25H,7,11-13H2,1H3/b24-18+,26-8+ |
| InChIKey | RKARQMQRGXKZQX-ISLFPBEASA-N |
| XLogP | 3.49 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.92 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|