C24H26ClN7O — CID 123147078
2-[3-[[3-[5-[(3-chlorophenyl)methyl]-12-methyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-4-yl]-3-iminopropylidene]amino]azetidin-1-yl]ethanol (PubChem CID 123147078) has the molecular formula C24H26ClN7O and a molecular weight of 463.97 g/mol. Its IUPAC name is 2-[3-[[3-[5-[(3-chlorophenyl)methyl]-12-methyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-4-yl]-3-iminopropylidene]amino]azetidin-1-yl]ethanol.
| Compound Name | 2-[3-[[3-[5-[(3-chlorophenyl)methyl]-12-methyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-4-yl]-3-iminopropylidene]amino]azetidin-1-yl]ethanol |
|---|---|
| PubChem CID | 123147078 |
| Molecular Formula | C24H26ClN7O |
| Molecular Weight | 463.97 g/mol |
| Exact Mass | 463.19 |
| IUPAC Name | 2-[3-[[3-[5-[(3-chlorophenyl)methyl]-12-methyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-4-yl]-3-iminopropylidene]amino]azetidin-1-yl]ethanol |
| SMILES | [H]/N=C(\C/C=N/C1CN(CCO)C1)c1cc2c(ccc3nnc(C)n32)n1Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C24H26ClN7O/c1-16-28-29-24-6-5-21-23(32(16)24)12-22(31(21)13-17-3-2-4-18(25)11-17)20(26)7-8-27-19-14-30(15-19)9-10-33/h2-6,8,11-12,19,26,33H,7,9-10,13-15H2,1H3/b26-20+,27-8+ |
| InChIKey | BIHQCGYCMGEIHZ-KUXMJURESA-N |
| XLogP | 3.20 |
| TPSA | 94.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.97 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|