C23H24ClN7O2S — CID 123534769
1-[5-[(3-chlorophenyl)methyl]-12-methyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-4-yl]-N'-(1-methylsulfonylazetidin-3-yl)propane-1,3-diimine (PubChem CID 123534769) has the molecular formula C23H24ClN7O2S and a molecular weight of 498.01 g/mol. Its IUPAC name is 1-[5-[(3-chlorophenyl)methyl]-12-methyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-4-yl]-N'-(1-methylsulfonylazetidin-3-yl)propane-1,3-diimine.
| Compound Name | 1-[5-[(3-chlorophenyl)methyl]-12-methyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-4-yl]-N'-(1-methylsulfonylazetidin-3-yl)propane-1,3-diimine |
|---|---|
| PubChem CID | 123534769 |
| Molecular Formula | C23H24ClN7O2S |
| Molecular Weight | 498.01 g/mol |
| Exact Mass | 497.14 |
| IUPAC Name | 1-[5-[(3-chlorophenyl)methyl]-12-methyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-4-yl]-N'-(1-methylsulfonylazetidin-3-yl)propane-1,3-diimine |
| SMILES | [H]/N=C(\C/C=N/C1CN(S(C)(=O)=O)C1)c1cc2c(ccc3nnc(C)n32)n1Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C23H24ClN7O2S/c1-15-27-28-23-7-6-20-22(31(15)23)11-21(30(20)12-16-4-3-5-17(24)10-16)19(25)8-9-26-18-13-29(14-18)34(2,32)33/h3-7,9-11,18,25H,8,12-14H2,1-2H3/b25-19+,26-9+ |
| InChIKey | RYFDMIPKYLLGFV-XMQQPJPWSA-N |
| XLogP | 3.17 |
| TPSA | 108.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.01 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|