C21H31N5O3 — CID 118166423
N'-(3-methoxypropyl)-N'-(piperidine-4-carbonyl)-2-propan-2-ylindazole-7-carbohydrazide (PubChem CID 118166423) has the molecular formula C21H31N5O3 and a molecular weight of 401.51 g/mol. Its IUPAC name is N'-(3-methoxypropyl)-N'-(piperidine-4-carbonyl)-2-propan-2-ylindazole-7-carbohydrazide.
| Compound Name | N'-(3-methoxypropyl)-N'-(piperidine-4-carbonyl)-2-propan-2-ylindazole-7-carbohydrazide |
|---|---|
| PubChem CID | 118166423 |
| Molecular Formula | C21H31N5O3 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.24 |
| IUPAC Name | N'-(3-methoxypropyl)-N'-(piperidine-4-carbonyl)-2-propan-2-ylindazole-7-carbohydrazide |
| SMILES | COCCCN(NC(=O)c1cccc2cn(C(C)C)nc12)C(=O)C1CCNCC1 |
| InChI | InChI=1S/C21H31N5O3/c1-15(2)26-14-17-6-4-7-18(19(17)23-26)20(27)24-25(12-5-13-29-3)21(28)16-8-10-22-11-9-16/h4,6-7,14-16,22H,5,8-13H2,1-3H3,(H,24,27) |
| InChIKey | YYWVQYISWLMDEM-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|