C23H34N4O — CID 118166413
N-[(1-cyclohexylpiperidin-4-yl)methyl]-2-propan-2-ylindazole-7-carboxamide (PubChem CID 118166413) has the molecular formula C23H34N4O and a molecular weight of 382.55 g/mol. Its IUPAC name is N-[(1-cyclohexylpiperidin-4-yl)methyl]-2-propan-2-ylindazole-7-carboxamide.
| Compound Name | N-[(1-cyclohexylpiperidin-4-yl)methyl]-2-propan-2-ylindazole-7-carboxamide |
|---|---|
| PubChem CID | 118166413 |
| Molecular Formula | C23H34N4O |
| Molecular Weight | 382.55 g/mol |
| Exact Mass | 382.27 |
| IUPAC Name | N-[(1-cyclohexylpiperidin-4-yl)methyl]-2-propan-2-ylindazole-7-carboxamide |
| SMILES | CC(C)n1cc2cccc(C(=O)NCC3CCN(C4CCCCC4)CC3)c2n1 |
| InChI | InChI=1S/C23H34N4O/c1-17(2)27-16-19-7-6-10-21(22(19)25-27)23(28)24-15-18-11-13-26(14-12-18)20-8-4-3-5-9-20/h6-7,10,16-18,20H,3-5,8-9,11-15H2,1-2H3,(H,24,28) |
| InChIKey | UUJXJVWLFVWCEV-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.55 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |