C21H23N5O2 — CID 67341288
2-[4-(piperidin-4-ylmethylcarbamoyl)phenyl]indazole-7-carboxamide (PubChem CID 67341288) has the molecular formula C21H23N5O2 and a molecular weight of 377.45 g/mol. Its IUPAC name is 2-[4-(piperidin-4-ylmethylcarbamoyl)phenyl]indazole-7-carboxamide.
| Compound Name | 2-[4-(piperidin-4-ylmethylcarbamoyl)phenyl]indazole-7-carboxamide |
|---|---|
| PubChem CID | 67341288 |
| Molecular Formula | C21H23N5O2 |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | 2-[4-(piperidin-4-ylmethylcarbamoyl)phenyl]indazole-7-carboxamide |
| SMILES | NC(=O)c1cccc2cn(-c3ccc(C(=O)NCC4CCNCC4)cc3)nc12 |
| InChI | InChI=1S/C21H23N5O2/c22-20(27)18-3-1-2-16-13-26(25-19(16)18)17-6-4-15(5-7-17)21(28)24-12-14-8-10-23-11-9-14/h1-7,13-14,23H,8-12H2,(H2,22,27)(H,24,28) |
| InChIKey | ZJFNJONPKHXIQI-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 102.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |