About 6-chloro-3-[(3S,4S)-3-fluoropiperidin-4-yl]oxypyridazine-4-carboxamide
6-chloro-3-[(3S,4S)-3-fluoropiperidin-4-yl]oxypyridazine-4-carboxamide (PubChem CID 118167833) has the molecular formula C10H12ClFN4O2
and a molecular weight of 274.68 g/mol. Its IUPAC name is 6-chloro-3-[(3S,4S)-3-fluoropiperidin-4-yl]oxypyridazine-4-carboxamide.
Molecular Properties
| Compound Name | 6-chloro-3-[(3S,4S)-3-fluoropiperidin-4-yl]oxypyridazine-4-carboxamide |
| PubChem CID | 118167833 |
| Molecular Formula | C10H12ClFN4O2 |
| Molecular Weight | 274.68 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | 6-chloro-3-[(3S,4S)-3-fluoropiperidin-4-yl]oxypyridazine-4-carboxamide |
| SMILES | NC(=O)c1cc(Cl)nnc1O[C@H]1CCNC[C@@H]1F |
| InChI | InChI=1S/C10H12ClFN4O2/c11-8-3-5(9(13)17)10(16-15-8)18-7-1-2-14-4-6(7)12/h3,6-7,14H,1-2,4H2,(H2,13,17)/t6-,7-/m0/s1 |
| InChIKey | FVVHYIRCKKMRQO-BQBZGAKWSA-N |
| XLogP | 0.31 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.68 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-chloro-3-[(3S,4S)-3-fluoropiperidin-4-yl]oxypyridazine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-3-[(3S,4S)-3-fluoropiperidin-4-yl]oxypyridazine-4-carboxamide?
The IUPAC name of 6-chloro-3-[(3S,4S)-3-fluoropiperidin-4-yl]oxypyridazine-4-carboxamide (CID 118167833) is 6-chloro-3-[(3S,4S)-3-fluoropiperidin-4-yl]oxypyridazine-4-carboxamide.
What is the SMILES notation for 6-chloro-3-[(3S,4S)-3-fluoropiperidin-4-yl]oxypyridazine-4-carboxamide?
The canonical SMILES for 6-chloro-3-[(3S,4S)-3-fluoropiperidin-4-yl]oxypyridazine-4-carboxamide is NC(=O)c1cc(Cl)nnc1O[C@H]1CCNC[C@@H]1F.
What is the InChIKey of 6-chloro-3-[(3S,4S)-3-fluoropiperidin-4-yl]oxypyridazine-4-carboxamide?
The InChIKey is FVVHYIRCKKMRQO-BQBZGAKWSA-N. The full InChI is InChI=1S/C10H12ClFN4O2/c11-8-3-5(9(13)17)10(16-15-8)18-7-1-2-14-4-6(7)12/h3,6-7,14H,1-2,4H2,(H2,13,17)/t6-,7-/m0/s1.
What are the key properties of 6-chloro-3-[(3S,4S)-3-fluoropiperidin-4-yl]oxypyridazine-4-carboxamide?
6-chloro-3-[(3S,4S)-3-fluoropiperidin-4-yl]oxypyridazine-4-carboxamide has a molecular weight of 274.68 g/mol, XLogP of 0.31, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-3-[(3S,4S)-3-fluoropiperidin-4-yl]oxypyridazine-4-carboxamide is sourced from PubChem (CID 118167833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).