C26H29N5O2S — CID 118168520
8-(cyclohexylamino)-N-[(6-methyl-1-oxidopyridin-1-ium-3-yl)methyl]-3-(5-methylthiophen-2-yl)imidazo[1,2-a]pyridine-6-carboxamide (PubChem CID 118168520) has the molecular formula C26H29N5O2S and a molecular weight of 475.62 g/mol. Its IUPAC name is 8-(cyclohexylamino)-N-[(6-methyl-1-oxidopyridin-1-ium-3-yl)methyl]-3-(5-methylthiophen-2-yl)imidazo[1,2-a]pyridine-6-carboxamide.
| Compound Name | 8-(cyclohexylamino)-N-[(6-methyl-1-oxidopyridin-1-ium-3-yl)methyl]-3-(5-methylthiophen-2-yl)imidazo[1,2-a]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 118168520 |
| Molecular Formula | C26H29N5O2S |
| Molecular Weight | 475.62 g/mol |
| Exact Mass | 475.20 |
| IUPAC Name | 8-(cyclohexylamino)-N-[(6-methyl-1-oxidopyridin-1-ium-3-yl)methyl]-3-(5-methylthiophen-2-yl)imidazo[1,2-a]pyridine-6-carboxamide |
| SMILES | Cc1ccc(-c2cnc3c(NC4CCCCC4)cc(C(=O)NCc4ccc(C)[n+]([O-])c4)cn23)s1 |
| InChI | InChI=1S/C26H29N5O2S/c1-17-8-10-19(15-31(17)33)13-28-26(32)20-12-22(29-21-6-4-3-5-7-21)25-27-14-23(30(25)16-20)24-11-9-18(2)34-24/h8-12,14-16,21,29H,3-7,13H2,1-2H3,(H,28,32) |
| InChIKey | SBWMBRDZOADONO-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.62 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|