C25H28N5O2S+ — CID 123497789
N-[(1-hydroxypyridin-1-ium-3-yl)methyl]-8-(4-methylpiperidin-1-yl)-3-(5-methylthiophen-2-yl)imidazo[1,2-a]pyridine-6-carboxamide (PubChem CID 123497789) has the molecular formula C25H28N5O2S+ and a molecular weight of 462.60 g/mol. Its IUPAC name is N-[(1-hydroxypyridin-1-ium-3-yl)methyl]-8-(4-methylpiperidin-1-yl)-3-(5-methylthiophen-2-yl)imidazo[1,2-a]pyridine-6-carboxamide.
| Compound Name | N-[(1-hydroxypyridin-1-ium-3-yl)methyl]-8-(4-methylpiperidin-1-yl)-3-(5-methylthiophen-2-yl)imidazo[1,2-a]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 123497789 |
| Molecular Formula | C25H28N5O2S+ |
| Molecular Weight | 462.60 g/mol |
| Exact Mass | 462.20 |
| IUPAC Name | N-[(1-hydroxypyridin-1-ium-3-yl)methyl]-8-(4-methylpiperidin-1-yl)-3-(5-methylthiophen-2-yl)imidazo[1,2-a]pyridine-6-carboxamide |
| SMILES | Cc1ccc(-c2cnc3c(N4CCC(C)CC4)cc(C(=O)NCc4ccc[n+](O)c4)cn23)s1 |
| InChI | InChI=1S/C25H27N5O2S/c1-17-7-10-28(11-8-17)21-12-20(25(31)27-13-19-4-3-9-29(32)15-19)16-30-22(14-26-24(21)30)23-6-5-18(2)33-23/h3-6,9,12,14-17H,7-8,10-11,13H2,1-2H3,(H-,27,31,32)/p+1 |
| InChIKey | LZMAIQQVMLRZBZ-UHFFFAOYSA-O |
| XLogP | 4.06 |
| TPSA | 73.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.60 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|