C24H22N6O2S — CID 118168010
N-[(6-methyl-1-oxidopyridin-1-ium-3-yl)methyl]-8-(1-methylpyrazol-4-yl)-3-(5-methylthiophen-2-yl)imidazo[1,2-a]pyridine-6-carboxamide (PubChem CID 118168010) has the molecular formula C24H22N6O2S and a molecular weight of 458.55 g/mol. Its IUPAC name is N-[(6-methyl-1-oxidopyridin-1-ium-3-yl)methyl]-8-(1-methylpyrazol-4-yl)-3-(5-methylthiophen-2-yl)imidazo[1,2-a]pyridine-6-carboxamide.
| Compound Name | N-[(6-methyl-1-oxidopyridin-1-ium-3-yl)methyl]-8-(1-methylpyrazol-4-yl)-3-(5-methylthiophen-2-yl)imidazo[1,2-a]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 118168010 |
| Molecular Formula | C24H22N6O2S |
| Molecular Weight | 458.55 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | N-[(6-methyl-1-oxidopyridin-1-ium-3-yl)methyl]-8-(1-methylpyrazol-4-yl)-3-(5-methylthiophen-2-yl)imidazo[1,2-a]pyridine-6-carboxamide |
| SMILES | Cc1ccc(-c2cnc3c(-c4cnn(C)c4)cc(C(=O)NCc4ccc(C)[n+]([O-])c4)cn23)s1 |
| InChI | InChI=1S/C24H22N6O2S/c1-15-4-6-17(12-30(15)32)9-26-24(31)18-8-20(19-10-27-28(3)13-19)23-25-11-21(29(23)14-18)22-7-5-16(2)33-22/h4-8,10-14H,9H2,1-3H3,(H,26,31) |
| InChIKey | QEPGVLDPLKXWMD-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.55 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|