C20H20F2N8O2S — CID 144870539
8-[(2,2-difluoro-1-hydrazinylpropylidene)amino]-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-3-(5-methylthiophen-2-yl)imidazo[1,2-a]pyridine-6-carboxamide (PubChem CID 144870539) has the molecular formula C20H20F2N8O2S and a molecular weight of 474.50 g/mol. Its IUPAC name is 8-[(2,2-difluoro-1-hydrazinylpropylidene)amino]-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-3-(5-methylthiophen-2-yl)imidazo[1,2-a]pyridine-6-carboxamide.
| Compound Name | 8-[(2,2-difluoro-1-hydrazinylpropylidene)amino]-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-3-(5-methylthiophen-2-yl)imidazo[1,2-a]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 144870539 |
| Molecular Formula | C20H20F2N8O2S |
| Molecular Weight | 474.50 g/mol |
| Exact Mass | 474.14 |
| IUPAC Name | 8-[(2,2-difluoro-1-hydrazinylpropylidene)amino]-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-3-(5-methylthiophen-2-yl)imidazo[1,2-a]pyridine-6-carboxamide |
| SMILES | Cc1noc(CNC(=O)c2cc(/N=C(\NN)C(C)(F)F)c3ncc(-c4ccc(C)s4)n3c2)n1 |
| InChI | InChI=1S/C20H20F2N8O2S/c1-10-4-5-15(33-10)14-7-24-17-13(27-19(28-23)20(3,21)22)6-12(9-30(14)17)18(31)25-8-16-26-11(2)29-32-16/h4-7,9H,8,23H2,1-3H3,(H,25,31)(H,27,28) |
| InChIKey | PYTODKMPORFEBR-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 135.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.50 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|