C11H12INOS3 — CID 1181694
N-(4-iodo-2-methylphenyl)-1,3,5-trithiane-2-carboxamide (PubChem CID 1181694) has the molecular formula C11H12INOS3 and a molecular weight of 397.33 g/mol. Its IUPAC name is N-(4-iodo-2-methylphenyl)-1,3,5-trithiane-2-carboxamide.
| Compound Name | N-(4-iodo-2-methylphenyl)-1,3,5-trithiane-2-carboxamide |
|---|---|
| PubChem CID | 1181694 |
| Molecular Formula | C11H12INOS3 |
| Molecular Weight | 397.33 g/mol |
| Exact Mass | 396.91 |
| IUPAC Name | N-(4-iodo-2-methylphenyl)-1,3,5-trithiane-2-carboxamide |
| SMILES | Cc1cc(I)ccc1NC(=O)C1SCSCS1 |
| InChI | InChI=1S/C11H12INOS3/c1-7-4-8(12)2-3-9(7)13-10(14)11-16-5-15-6-17-11/h2-4,11H,5-6H2,1H3,(H,13,14) |
| InChIKey | UNWBCVOLLVGKEJ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.33 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|