C18H25N3O3 — CID 118170112
ethyl 3-[3-(hydroxymethyl)-4-methylphenyl]-5-(1-methyltriazol-4-yl)pentanoate (PubChem CID 118170112) has the molecular formula C18H25N3O3 and a molecular weight of 331.42 g/mol. Its IUPAC name is ethyl 3-[3-(hydroxymethyl)-4-methylphenyl]-5-(1-methyltriazol-4-yl)pentanoate.
| Compound Name | ethyl 3-[3-(hydroxymethyl)-4-methylphenyl]-5-(1-methyltriazol-4-yl)pentanoate |
|---|---|
| PubChem CID | 118170112 |
| Molecular Formula | C18H25N3O3 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | ethyl 3-[3-(hydroxymethyl)-4-methylphenyl]-5-(1-methyltriazol-4-yl)pentanoate |
| SMILES | CCOC(=O)CC(CCc1cn(C)nn1)c1ccc(C)c(CO)c1 |
| InChI | InChI=1S/C18H25N3O3/c1-4-24-18(23)10-15(7-8-17-11-21(3)20-19-17)14-6-5-13(2)16(9-14)12-22/h5-6,9,11,15,22H,4,7-8,10,12H2,1-3H3 |
| InChIKey | KMIDBSKNIISQLC-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |