C17H23IN2O3 — CID 118174395
tert-butyl 3'-iodo-3-methylspiro[5H-furo[3,4-b]pyridine-7,4'-piperidine]-1'-carboxylate (PubChem CID 118174395) has the molecular formula C17H23IN2O3 and a molecular weight of 430.29 g/mol. Its IUPAC name is tert-butyl 3'-iodo-3-methylspiro[5H-furo[3,4-b]pyridine-7,4'-piperidine]-1'-carboxylate.
| Compound Name | tert-butyl 3'-iodo-3-methylspiro[5H-furo[3,4-b]pyridine-7,4'-piperidine]-1'-carboxylate |
|---|---|
| PubChem CID | 118174395 |
| Molecular Formula | C17H23IN2O3 |
| Molecular Weight | 430.29 g/mol |
| Exact Mass | 430.08 |
| IUPAC Name | tert-butyl 3'-iodo-3-methylspiro[5H-furo[3,4-b]pyridine-7,4'-piperidine]-1'-carboxylate |
| SMILES | Cc1cnc2c(c1)COC21CCN(C(=O)OC(C)(C)C)CC1I |
| InChI | InChI=1S/C17H23IN2O3/c1-11-7-12-10-22-17(14(12)19-8-11)5-6-20(9-13(17)18)15(21)23-16(2,3)4/h7-8,13H,5-6,9-10H2,1-4H3 |
| InChIKey | IKRXMMXCODAWAJ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.29 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|