C31H35IN2O4 — CID 149431849
tert-butyl (1R,3'S)-3'-[4-[2-(iodomethyl)phenyl]-2-methylphenyl]-6-methoxyspiro[3H-furo[3,4-c]pyridine-1,4'-piperidine]-1'-carboxylate (PubChem CID 149431849) has the molecular formula C31H35IN2O4 and a molecular weight of 626.54 g/mol. Its IUPAC name is tert-butyl (1R,3'S)-3'-[4-[2-(iodomethyl)phenyl]-2-methylphenyl]-6-methoxyspiro[3H-furo[3,4-c]pyridine-1,4'-piperidine]-1'-carboxylate.
| Compound Name | tert-butyl (1R,3'S)-3'-[4-[2-(iodomethyl)phenyl]-2-methylphenyl]-6-methoxyspiro[3H-furo[3,4-c]pyridine-1,4'-piperidine]-1'-carboxylate |
|---|---|
| PubChem CID | 149431849 |
| Molecular Formula | C31H35IN2O4 |
| Molecular Weight | 626.54 g/mol |
| Exact Mass | 626.16 |
| IUPAC Name | tert-butyl (1R,3'S)-3'-[4-[2-(iodomethyl)phenyl]-2-methylphenyl]-6-methoxyspiro[3H-furo[3,4-c]pyridine-1,4'-piperidine]-1'-carboxylate |
| SMILES | COc1cc2c(cn1)CO[C@@]21CCN(C(=O)OC(C)(C)C)C[C@@H]1c1ccc(-c2ccccc2CI)cc1C |
| InChI | InChI=1S/C31H35IN2O4/c1-20-14-21(25-9-7-6-8-22(25)16-32)10-11-24(20)27-18-34(29(35)38-30(2,3)4)13-12-31(27)26-15-28(36-5)33-17-23(26)19-37-31/h6-11,14-15,17,27H,12-13,16,18-19H2,1-5H3/t27-,31+/m1/s1 |
| InChIKey | JAMIEPURFVIMTA-JOMNFKBKSA-N |
| XLogP | 7.15 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.54 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|