C18H17N3O6 — CID 118176815
2-[[4-hydroxy-6-oxo-1-[(3-phenyl-1,2-oxazol-5-yl)methyl]-2,3-dihydropyridine-5-carbonyl]amino]acetic acid (PubChem CID 118176815) has the molecular formula C18H17N3O6 and a molecular weight of 371.35 g/mol. Its IUPAC name is 2-[[4-hydroxy-6-oxo-1-[(3-phenyl-1,2-oxazol-5-yl)methyl]-2,3-dihydropyridine-5-carbonyl]amino]acetic acid.
| Compound Name | 2-[[4-hydroxy-6-oxo-1-[(3-phenyl-1,2-oxazol-5-yl)methyl]-2,3-dihydropyridine-5-carbonyl]amino]acetic acid |
|---|---|
| PubChem CID | 118176815 |
| Molecular Formula | C18H17N3O6 |
| Molecular Weight | 371.35 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | 2-[[4-hydroxy-6-oxo-1-[(3-phenyl-1,2-oxazol-5-yl)methyl]-2,3-dihydropyridine-5-carbonyl]amino]acetic acid |
| SMILES | O=C(O)CNC(=O)C1=C(O)CCN(Cc2cc(-c3ccccc3)no2)C1=O |
| InChI | InChI=1S/C18H17N3O6/c22-14-6-7-21(18(26)16(14)17(25)19-9-15(23)24)10-12-8-13(20-27-12)11-4-2-1-3-5-11/h1-5,8,22H,6-7,9-10H2,(H,19,25)(H,23,24) |
| InChIKey | NVSOGENOMSGHTA-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 132.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.35 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|