C21H21N3O5S — CID 118176898
2-[[8-hydroxy-6-oxo-5-[(2-phenyl-1,3-thiazol-5-yl)methyl]-5-azaspiro[3.5]non-7-ene-7-carbonyl]amino]acetic acid (PubChem CID 118176898) has the molecular formula C21H21N3O5S and a molecular weight of 427.48 g/mol. Its IUPAC name is 2-[[8-hydroxy-6-oxo-5-[(2-phenyl-1,3-thiazol-5-yl)methyl]-5-azaspiro[3.5]non-7-ene-7-carbonyl]amino]acetic acid.
| Compound Name | 2-[[8-hydroxy-6-oxo-5-[(2-phenyl-1,3-thiazol-5-yl)methyl]-5-azaspiro[3.5]non-7-ene-7-carbonyl]amino]acetic acid |
|---|---|
| PubChem CID | 118176898 |
| Molecular Formula | C21H21N3O5S |
| Molecular Weight | 427.48 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | 2-[[8-hydroxy-6-oxo-5-[(2-phenyl-1,3-thiazol-5-yl)methyl]-5-azaspiro[3.5]non-7-ene-7-carbonyl]amino]acetic acid |
| SMILES | O=C(O)CNC(=O)C1=C(O)CC2(CCC2)N(Cc2cnc(-c3ccccc3)s2)C1=O |
| InChI | InChI=1S/C21H21N3O5S/c25-15-9-21(7-4-8-21)24(20(29)17(15)18(28)22-11-16(26)27)12-14-10-23-19(30-14)13-5-2-1-3-6-13/h1-3,5-6,10,25H,4,7-9,11-12H2,(H,22,28)(H,26,27) |
| InChIKey | RTCMNLHBXBKWQC-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 119.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.48 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|