C14H20N2O5 — CID 118177055
2-[(1-cyclohexyl-4-hydroxy-6-oxo-2,3-dihydropyridine-5-carbonyl)amino]acetic acid (PubChem CID 118177055) has the molecular formula C14H20N2O5 and a molecular weight of 296.32 g/mol. Its IUPAC name is 2-[(1-cyclohexyl-4-hydroxy-6-oxo-2,3-dihydropyridine-5-carbonyl)amino]acetic acid.
| Compound Name | 2-[(1-cyclohexyl-4-hydroxy-6-oxo-2,3-dihydropyridine-5-carbonyl)amino]acetic acid |
|---|---|
| PubChem CID | 118177055 |
| Molecular Formula | C14H20N2O5 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | 2-[(1-cyclohexyl-4-hydroxy-6-oxo-2,3-dihydropyridine-5-carbonyl)amino]acetic acid |
| SMILES | O=C(O)CNC(=O)C1=C(O)CCN(C2CCCCC2)C1=O |
| InChI | InChI=1S/C14H20N2O5/c17-10-6-7-16(9-4-2-1-3-5-9)14(21)12(10)13(20)15-8-11(18)19/h9,17H,1-8H2,(H,15,20)(H,18,19) |
| InChIKey | HXKWJPRFGYIAQD-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|