C25H42O3 — CID 118179644
2-[2-[(3R,3aR)-3a,7-dimethyl-3-[(2-methylpropan-2-yl)oxy]-1,2,3,4,5,5a,8,9,9a,9b-decahydrocyclopenta[a]naphthalen-6-yl]ethyl]-2-methyl-1,3-dioxolane (PubChem CID 118179644) has the molecular formula C25H42O3 and a molecular weight of 390.61 g/mol. Its IUPAC name is 2-[2-[(3R,3aR)-3a,7-dimethyl-3-[(2-methylpropan-2-yl)oxy]-1,2,3,4,5,5a,8,9,9a,9b-decahydrocyclopenta[a]naphthalen-6-yl]ethyl]-2-methyl-1,3-dioxolane.
| Compound Name | 2-[2-[(3R,3aR)-3a,7-dimethyl-3-[(2-methylpropan-2-yl)oxy]-1,2,3,4,5,5a,8,9,9a,9b-decahydrocyclopenta[a]naphthalen-6-yl]ethyl]-2-methyl-1,3-dioxolane |
|---|---|
| PubChem CID | 118179644 |
| Molecular Formula | C25H42O3 |
| Molecular Weight | 390.61 g/mol |
| Exact Mass | 390.31 |
| IUPAC Name | 2-[2-[(3R,3aR)-3a,7-dimethyl-3-[(2-methylpropan-2-yl)oxy]-1,2,3,4,5,5a,8,9,9a,9b-decahydrocyclopenta[a]naphthalen-6-yl]ethyl]-2-methyl-1,3-dioxolane |
| SMILES | CC1=C(CCC2(C)OCCO2)C2CC[C@]3(C)C(CC[C@H]3OC(C)(C)C)C2CC1 |
| InChI | InChI=1S/C25H42O3/c1-17-7-8-20-19(18(17)12-14-25(6)26-15-16-27-25)11-13-24(5)21(20)9-10-22(24)28-23(2,3)4/h19-22H,7-16H2,1-6H3/t19?,20?,21?,22-,24-/m1/s1 |
| InChIKey | UEXRPQZLPBCHMS-CMTVVOJYSA-N |
| XLogP | 6.27 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.61 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|