C19H27N3O5 — CID 118182503
ethyl 2-[5-[(2-methylpropan-2-yl)oxycarbonylamino]-6-propan-2-yloxyindazol-2-yl]acetate (PubChem CID 118182503) has the molecular formula C19H27N3O5 and a molecular weight of 377.44 g/mol. Its IUPAC name is ethyl 2-[5-[(2-methylpropan-2-yl)oxycarbonylamino]-6-propan-2-yloxyindazol-2-yl]acetate.
| Compound Name | ethyl 2-[5-[(2-methylpropan-2-yl)oxycarbonylamino]-6-propan-2-yloxyindazol-2-yl]acetate |
|---|---|
| PubChem CID | 118182503 |
| Molecular Formula | C19H27N3O5 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | ethyl 2-[5-[(2-methylpropan-2-yl)oxycarbonylamino]-6-propan-2-yloxyindazol-2-yl]acetate |
| SMILES | CCOC(=O)Cn1cc2cc(NC(=O)OC(C)(C)C)c(OC(C)C)cc2n1 |
| InChI | InChI=1S/C19H27N3O5/c1-7-25-17(23)11-22-10-13-8-15(20-18(24)27-19(4,5)6)16(26-12(2)3)9-14(13)21-22/h8-10,12H,7,11H2,1-6H3,(H,20,24) |
| InChIKey | FSBLEOIOACLUPY-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |