C14H17FIN3O2 — CID 164567715
tert-butyl N-[6-fluoro-2-(2-iodoethyl)indazol-5-yl]carbamate (PubChem CID 164567715) has the molecular formula C14H17FIN3O2 and a molecular weight of 405.21 g/mol. Its IUPAC name is tert-butyl N-[6-fluoro-2-(2-iodoethyl)indazol-5-yl]carbamate.
| Compound Name | tert-butyl N-[6-fluoro-2-(2-iodoethyl)indazol-5-yl]carbamate |
|---|---|
| PubChem CID | 164567715 |
| Molecular Formula | C14H17FIN3O2 |
| Molecular Weight | 405.21 g/mol |
| Exact Mass | 405.03 |
| IUPAC Name | tert-butyl N-[6-fluoro-2-(2-iodoethyl)indazol-5-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cc2cn(CCI)nc2cc1F |
| InChI | InChI=1S/C14H17FIN3O2/c1-14(2,3)21-13(20)17-12-6-9-8-19(5-4-16)18-11(9)7-10(12)15/h6-8H,4-5H2,1-3H3,(H,17,20) |
| InChIKey | CKCRURVTPLSCQU-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.21 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|