C21H23ClFN3O2 — CID 172698350
tert-butyl N-[3-[5-chloro-6-(2-fluorophenyl)indazol-2-yl]propyl]carbamate (PubChem CID 172698350) has the molecular formula C21H23ClFN3O2 and a molecular weight of 403.89 g/mol. Its IUPAC name is tert-butyl N-[3-[5-chloro-6-(2-fluorophenyl)indazol-2-yl]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[5-chloro-6-(2-fluorophenyl)indazol-2-yl]propyl]carbamate |
|---|---|
| PubChem CID | 172698350 |
| Molecular Formula | C21H23ClFN3O2 |
| Molecular Weight | 403.89 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | tert-butyl N-[3-[5-chloro-6-(2-fluorophenyl)indazol-2-yl]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCn1cc2cc(Cl)c(-c3ccccc3F)cc2n1 |
| InChI | InChI=1S/C21H23ClFN3O2/c1-21(2,3)28-20(27)24-9-6-10-26-13-14-11-17(22)16(12-19(14)25-26)15-7-4-5-8-18(15)23/h4-5,7-8,11-13H,6,9-10H2,1-3H3,(H,24,27) |
| InChIKey | CPVSIGDKYLWNRM-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.89 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|