About 2-methylocta-2,3,4-triene
2-methylocta-2,3,4-triene (PubChem CID 11819084) has the molecular formula C9H14
and a molecular weight of 122.21 g/mol. Its IUPAC name is 2-methylocta-2,3,4-triene.
Molecular Properties
| Compound Name | 2-methylocta-2,3,4-triene |
| PubChem CID | 11819084 |
| Molecular Formula | C9H14 |
| Molecular Weight | 122.21 g/mol |
| Exact Mass | 122.11 |
| IUPAC Name | 2-methylocta-2,3,4-triene |
| SMILES | CCCC=C=C=C(C)C |
| InChI | InChI=1S/C9H14/c1-4-5-6-7-8-9(2)3/h6H,4-5H2,1-3H3 |
| InChIKey | LOZUKYMWZMXTAE-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.21 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-methylocta-2,3,4-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylocta-2,3,4-triene?
The IUPAC name of 2-methylocta-2,3,4-triene (CID 11819084) is 2-methylocta-2,3,4-triene.
What is the SMILES notation for 2-methylocta-2,3,4-triene?
The canonical SMILES for 2-methylocta-2,3,4-triene is CCCC=C=C=C(C)C.
What is the InChIKey of 2-methylocta-2,3,4-triene?
The InChIKey is LOZUKYMWZMXTAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14/c1-4-5-6-7-8-9(2)3/h6H,4-5H2,1-3H3.
What are the key properties of 2-methylocta-2,3,4-triene?
2-methylocta-2,3,4-triene has a molecular weight of 122.21 g/mol, XLogP of 3.06, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylocta-2,3,4-triene is sourced from PubChem (CID 11819084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).