C9H14 — CID 11819084
2-methylocta-2,3,4-triene (PubChem CID 11819084) has the molecular formula C9H14 and a molecular weight of 122.21 g/mol. Its IUPAC name is 2-methylocta-2,3,4-triene.
| Compound Name | 2-methylocta-2,3,4-triene |
|---|---|
| PubChem CID | 11819084 |
| Molecular Formula | C9H14 |
| Molecular Weight | 122.21 g/mol |
| Exact Mass | 122.11 |
| IUPAC Name | 2-methylocta-2,3,4-triene |
| SMILES | CCCC=C=C=C(C)C |
| InChI | InChI=1S/C9H14/c1-4-5-6-7-8-9(2)3/h6H,4-5H2,1-3H3 |
| InChIKey | LOZUKYMWZMXTAE-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 122.21 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |