About 3-methylocta-1,3,4-triene
3-methylocta-1,3,4-triene (PubChem CID 176714902) has the molecular formula C9H14
and a molecular weight of 122.21 g/mol. Its IUPAC name is 3-methylocta-1,3,4-triene.
Molecular Properties
| Compound Name | 3-methylocta-1,3,4-triene |
| PubChem CID | 176714902 |
| Molecular Formula | C9H14 |
| Molecular Weight | 122.21 g/mol |
| Exact Mass | 122.11 |
| IUPAC Name | 3-methylocta-1,3,4-triene |
| SMILES | C=CC(C)=C=CCCC |
| InChI | InChI=1S/C9H14/c1-4-6-7-8-9(3)5-2/h5,7H,2,4,6H2,1,3H3 |
| InChIKey | MEEXBGUOCNNVOM-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.21 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 3-methylocta-1,3,4-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylocta-1,3,4-triene?
The IUPAC name of 3-methylocta-1,3,4-triene (CID 176714902) is 3-methylocta-1,3,4-triene.
What is the SMILES notation for 3-methylocta-1,3,4-triene?
The canonical SMILES for 3-methylocta-1,3,4-triene is C=CC(C)=C=CCCC.
What is the InChIKey of 3-methylocta-1,3,4-triene?
The InChIKey is MEEXBGUOCNNVOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14/c1-4-6-7-8-9(3)5-2/h5,7H,2,4,6H2,1,3H3.
What are the key properties of 3-methylocta-1,3,4-triene?
3-methylocta-1,3,4-triene has a molecular weight of 122.21 g/mol, XLogP of 3.07, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylocta-1,3,4-triene is sourced from PubChem (CID 176714902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).