C9H16OS — CID 44719800
3-methylsulfanylocta-3,4-dien-1-ol (PubChem CID 44719800) has the molecular formula C9H16OS and a molecular weight of 172.29 g/mol. Its IUPAC name is 3-methylsulfanylocta-3,4-dien-1-ol.
| Compound Name | 3-methylsulfanylocta-3,4-dien-1-ol |
|---|---|
| PubChem CID | 44719800 |
| Molecular Formula | C9H16OS |
| Molecular Weight | 172.29 g/mol |
| Exact Mass | 172.09 |
| IUPAC Name | 3-methylsulfanylocta-3,4-dien-1-ol |
| SMILES | CCCC=C=C(CCO)SC |
| InChI | InChI=1S/C9H16OS/c1-3-4-5-6-9(11-2)7-8-10/h5,10H,3-4,7-8H2,1-2H3 |
| InChIKey | CSFSQHAOVJERNL-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.29 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |