C6H10S — CID 119097771
3-methylsulfanylpenta-1,2-diene (PubChem CID 119097771) has the molecular formula C6H10S and a molecular weight of 114.21 g/mol. Its IUPAC name is 3-methylsulfanylpenta-1,2-diene.
| Compound Name | 3-methylsulfanylpenta-1,2-diene |
|---|---|
| PubChem CID | 119097771 |
| Molecular Formula | C6H10S |
| Molecular Weight | 114.21 g/mol |
| Exact Mass | 114.05 |
| IUPAC Name | 3-methylsulfanylpenta-1,2-diene |
| SMILES | C=C=C(CC)SC |
| InChI | InChI=1S/C6H10S/c1-4-6(5-2)7-3/h1,5H2,2-3H3 |
| InChIKey | VYGHMXQKSPZESM-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 114.21 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |