C7H10S — CID 89172686
4-methyl-3-methylsulfanylpenta-1,2,4-triene (PubChem CID 89172686) has the molecular formula C7H10S and a molecular weight of 126.22 g/mol. Its IUPAC name is 4-methyl-3-methylsulfanylpenta-1,2,4-triene.
| Compound Name | 4-methyl-3-methylsulfanylpenta-1,2,4-triene |
|---|---|
| PubChem CID | 89172686 |
| Molecular Formula | C7H10S |
| Molecular Weight | 126.22 g/mol |
| Exact Mass | 126.05 |
| IUPAC Name | 4-methyl-3-methylsulfanylpenta-1,2,4-triene |
| SMILES | C=C=C(SC)C(=C)C |
| InChI | InChI=1S/C7H10S/c1-5-7(8-4)6(2)3/h1-2H2,3-4H3 |
| InChIKey | QNLZLPPJVSAGDK-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.22 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|