C8H10 — CID 156766349
3-methylhepta-1,3,4,6-tetraene (PubChem CID 156766349) has the molecular formula C8H10 and a molecular weight of 106.17 g/mol. Its IUPAC name is 3-methylhepta-1,3,4,6-tetraene.
| Compound Name | 3-methylhepta-1,3,4,6-tetraene |
|---|---|
| PubChem CID | 156766349 |
| Molecular Formula | C8H10 |
| Molecular Weight | 106.17 g/mol |
| Exact Mass | 106.08 |
| IUPAC Name | 3-methylhepta-1,3,4,6-tetraene |
| SMILES | C=CC=C=C(C)C=C |
| InChI | InChI=1S/C8H10/c1-4-6-7-8(3)5-2/h4-6H,1-2H2,3H3 |
| InChIKey | BTPBXEBAHUAJQH-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 106.17 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|