About dimethyl(2-methylbuta-1,3-dienylidene)azanium
dimethyl(2-methylbuta-1,3-dienylidene)azanium (PubChem CID 134867484) has the molecular formula C7H12N+
and a molecular weight of 110.18 g/mol. Its IUPAC name is dimethyl(2-methylbuta-1,3-dienylidene)azanium.
Molecular Properties
| Compound Name | dimethyl(2-methylbuta-1,3-dienylidene)azanium |
| PubChem CID | 134867484 |
| Molecular Formula | C7H12N+ |
| Molecular Weight | 110.18 g/mol |
| Exact Mass | 110.10 |
| IUPAC Name | dimethyl(2-methylbuta-1,3-dienylidene)azanium |
| SMILES | C=CC(C)=C=[N+](C)C |
| InChI | InChI=1S/C7H12N/c1-5-7(2)6-8(3)4/h5H,1H2,2-4H3/q+1 |
| InChIKey | BUFJMNWINUZYSK-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 110.18 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze dimethyl(2-methylbuta-1,3-dienylidene)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl(2-methylbuta-1,3-dienylidene)azanium?
The IUPAC name of dimethyl(2-methylbuta-1,3-dienylidene)azanium (CID 134867484) is dimethyl(2-methylbuta-1,3-dienylidene)azanium.
What is the SMILES notation for dimethyl(2-methylbuta-1,3-dienylidene)azanium?
The canonical SMILES for dimethyl(2-methylbuta-1,3-dienylidene)azanium is C=CC(C)=C=[N+](C)C.
What is the InChIKey of dimethyl(2-methylbuta-1,3-dienylidene)azanium?
The InChIKey is BUFJMNWINUZYSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N/c1-5-7(2)6-8(3)4/h5H,1H2,2-4H3/q+1.
What are the key properties of dimethyl(2-methylbuta-1,3-dienylidene)azanium?
dimethyl(2-methylbuta-1,3-dienylidene)azanium has a molecular weight of 110.18 g/mol, XLogP of 1.06, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl(2-methylbuta-1,3-dienylidene)azanium is sourced from PubChem (CID 134867484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).