C7H6BrF — CID 145477089
2-bromo-3-fluorohepta-1,3,4,6-tetraene (PubChem CID 145477089) has the molecular formula C7H6BrF and a molecular weight of 189.03 g/mol. Its IUPAC name is 2-bromo-3-fluorohepta-1,3,4,6-tetraene.
| Compound Name | 2-bromo-3-fluorohepta-1,3,4,6-tetraene |
|---|---|
| PubChem CID | 145477089 |
| Molecular Formula | C7H6BrF |
| Molecular Weight | 189.03 g/mol |
| Exact Mass | 187.96 |
| IUPAC Name | 2-bromo-3-fluorohepta-1,3,4,6-tetraene |
| SMILES | C=CC=C=C(F)C(=C)Br |
| InChI | InChI=1S/C7H6BrF/c1-3-4-5-7(9)6(2)8/h3-4H,1-2H2 |
| InChIKey | WIEDQUYYMXVBRB-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.03 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|