About 3-bromo-1,1-difluoropropa-1,2-diene
3-bromo-1,1-difluoropropa-1,2-diene (PubChem CID 174189391) has the molecular formula C3HBrF2
and a molecular weight of 154.94 g/mol. Its IUPAC name is 3-bromo-1,1-difluoropropa-1,2-diene.
Molecular Properties
| Compound Name | 3-bromo-1,1-difluoropropa-1,2-diene |
| PubChem CID | 174189391 |
| Molecular Formula | C3HBrF2 |
| Molecular Weight | 154.94 g/mol |
| Exact Mass | 153.92 |
| IUPAC Name | 3-bromo-1,1-difluoropropa-1,2-diene |
| SMILES | FC(F)=C=CBr |
| InChI | InChI=1S/C3HBrF2/c4-2-1-3(5)6/h2H |
| InChIKey | XGVCVEREHYVNGH-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.94 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 3-bromo-1,1-difluoropropa-1,2-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-1,1-difluoropropa-1,2-diene?
The IUPAC name of 3-bromo-1,1-difluoropropa-1,2-diene (CID 174189391) is 3-bromo-1,1-difluoropropa-1,2-diene.
What is the SMILES notation for 3-bromo-1,1-difluoropropa-1,2-diene?
The canonical SMILES for 3-bromo-1,1-difluoropropa-1,2-diene is FC(F)=C=CBr.
What is the InChIKey of 3-bromo-1,1-difluoropropa-1,2-diene?
The InChIKey is XGVCVEREHYVNGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C3HBrF2/c4-2-1-3(5)6/h2H.
What are the key properties of 3-bromo-1,1-difluoropropa-1,2-diene?
3-bromo-1,1-difluoropropa-1,2-diene has a molecular weight of 154.94 g/mol, XLogP of 2.27, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-1,1-difluoropropa-1,2-diene is sourced from PubChem (CID 174189391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).