C3HBrF2 — CID 174189391
3-bromo-1,1-difluoropropa-1,2-diene (PubChem CID 174189391) has the molecular formula C3HBrF2 and a molecular weight of 154.94 g/mol. Its IUPAC name is 3-bromo-1,1-difluoropropa-1,2-diene.
| Compound Name | 3-bromo-1,1-difluoropropa-1,2-diene |
|---|---|
| PubChem CID | 174189391 |
| Molecular Formula | C3HBrF2 |
| Molecular Weight | 154.94 g/mol |
| Exact Mass | 153.92 |
| IUPAC Name | 3-bromo-1,1-difluoropropa-1,2-diene |
| SMILES | FC(F)=C=CBr |
| InChI | InChI=1S/C3HBrF2/c4-2-1-3(5)6/h2H |
| InChIKey | XGVCVEREHYVNGH-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.94 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |