About 2-bromo-1-fluoroethenol
2-bromo-1-fluoroethenol (PubChem CID 173340388) has the molecular formula C2H2BrFO
and a molecular weight of 140.94 g/mol. Its IUPAC name is 2-bromo-1-fluoroethenol.
Molecular Properties
| Compound Name | 2-bromo-1-fluoroethenol |
| PubChem CID | 173340388 |
| Molecular Formula | C2H2BrFO |
| Molecular Weight | 140.94 g/mol |
| Exact Mass | 139.93 |
| IUPAC Name | 2-bromo-1-fluoroethenol |
| SMILES | OC(F)=CBr |
| InChI | InChI=1S/C2H2BrFO/c3-1-2(4)5/h1,5H |
| InChIKey | KDNUMNHABIHPKT-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.94 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-1-fluoroethenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-1-fluoroethenol?
The IUPAC name of 2-bromo-1-fluoroethenol (CID 173340388) is 2-bromo-1-fluoroethenol.
What is the SMILES notation for 2-bromo-1-fluoroethenol?
The canonical SMILES for 2-bromo-1-fluoroethenol is OC(F)=CBr.
What is the InChIKey of 2-bromo-1-fluoroethenol?
The InChIKey is KDNUMNHABIHPKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H2BrFO/c3-1-2(4)5/h1,5H.
What are the key properties of 2-bromo-1-fluoroethenol?
2-bromo-1-fluoroethenol has a molecular weight of 140.94 g/mol, XLogP of 1.71, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-1-fluoroethenol is sourced from PubChem (CID 173340388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).