C3HClF2 — CID 101109098
1-chloro-1,3-difluoropropa-1,2-diene (PubChem CID 101109098) has the molecular formula C3HClF2 and a molecular weight of 110.49 g/mol. Its IUPAC name is 1-chloro-1,3-difluoropropa-1,2-diene.
| Compound Name | 1-chloro-1,3-difluoropropa-1,2-diene |
|---|---|
| PubChem CID | 101109098 |
| Molecular Formula | C3HClF2 |
| Molecular Weight | 110.49 g/mol |
| Exact Mass | 109.97 |
| IUPAC Name | 1-chloro-1,3-difluoropropa-1,2-diene |
| SMILES | FC=C=C(F)Cl |
| InChI | InChI=1S/C3HClF2/c4-3(6)1-2-5/h2H |
| InChIKey | UTLDBVYQKRKIPK-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 110.49 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |