C4HCl3S — CID 133064408
3,4,4-trichlorobuta-1,3-diene-1-thione (PubChem CID 133064408) has the molecular formula C4HCl3S and a molecular weight of 187.48 g/mol. Its IUPAC name is 3,4,4-trichlorobuta-1,3-diene-1-thione.
| Compound Name | 3,4,4-trichlorobuta-1,3-diene-1-thione |
|---|---|
| PubChem CID | 133064408 |
| Molecular Formula | C4HCl3S |
| Molecular Weight | 187.48 g/mol |
| Exact Mass | 185.89 |
| IUPAC Name | 3,4,4-trichlorobuta-1,3-diene-1-thione |
| SMILES | S=C=CC(Cl)=C(Cl)Cl |
| InChI | InChI=1S/C4HCl3S/c5-3(1-2-8)4(6)7/h1H |
| InChIKey | JVBRTSUEUZVSOX-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.48 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|