About 1,1-dichloro-3,3-difluoropropa-1,2-diene
1,1-dichloro-3,3-difluoropropa-1,2-diene (PubChem CID 101109100) has the molecular formula C3Cl2F2
and a molecular weight of 144.94 g/mol. Its IUPAC name is 1,1-dichloro-3,3-difluoropropa-1,2-diene.
Analyze 1,1-dichloro-3,3-difluoropropa-1,2-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dichloro-3,3-difluoropropa-1,2-diene?
The IUPAC name of 1,1-dichloro-3,3-difluoropropa-1,2-diene (CID 101109100) is 1,1-dichloro-3,3-difluoropropa-1,2-diene.
What is the SMILES notation for 1,1-dichloro-3,3-difluoropropa-1,2-diene?
The canonical SMILES for 1,1-dichloro-3,3-difluoropropa-1,2-diene is FC(F)=C=C(Cl)Cl.
What is the InChIKey of 1,1-dichloro-3,3-difluoropropa-1,2-diene?
The InChIKey is HVOKNBNMAXULEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C3Cl2F2/c4-2(5)1-3(6)7.
What are the key properties of 1,1-dichloro-3,3-difluoropropa-1,2-diene?
1,1-dichloro-3,3-difluoropropa-1,2-diene has a molecular weight of 144.94 g/mol, XLogP of 2.68, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dichloro-3,3-difluoropropa-1,2-diene is sourced from PubChem (CID 101109100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).