C6H7Cl — CID 123521663
5-chlorohexa-1,3,4-triene (PubChem CID 123521663) has the molecular formula C6H7Cl and a molecular weight of 114.57 g/mol. Its IUPAC name is 5-chlorohexa-1,3,4-triene.
| Compound Name | 5-chlorohexa-1,3,4-triene |
|---|---|
| PubChem CID | 123521663 |
| Molecular Formula | C6H7Cl |
| Molecular Weight | 114.57 g/mol |
| Exact Mass | 114.02 |
| IUPAC Name | 5-chlorohexa-1,3,4-triene |
| SMILES | C=CC=C=C(C)Cl |
| InChI | InChI=1S/C6H7Cl/c1-3-4-5-6(2)7/h3-4H,1H2,2H3 |
| InChIKey | XGXSYRUMLGBZLY-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 114.57 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|