C18H26 — CID 162524809
(7E,9Z)-5-butyl-7,10-dimethyldodeca-1,3,4,7,9,11-hexaene (PubChem CID 162524809) has the molecular formula C18H26 and a molecular weight of 242.41 g/mol. Its IUPAC name is (7E,9Z)-5-butyl-7,10-dimethyldodeca-1,3,4,7,9,11-hexaene.
| Compound Name | (7E,9Z)-5-butyl-7,10-dimethyldodeca-1,3,4,7,9,11-hexaene |
|---|---|
| PubChem CID | 162524809 |
| Molecular Formula | C18H26 |
| Molecular Weight | 242.41 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | (7E,9Z)-5-butyl-7,10-dimethyldodeca-1,3,4,7,9,11-hexaene |
| SMILES | C=CC=C=C(CCCC)C/C(C)=C/C=C(/C)C=C |
| InChI | InChI=1S/C18H26/c1-6-9-11-18(12-10-7-2)15-17(5)14-13-16(4)8-3/h6,8-9,13-14H,1,3,7,10,12,15H2,2,4-5H3/b16-13-,17-14+ |
| InChIKey | OATCHWNRBDYQGI-FEUFJANWSA-N |
| XLogP | 5.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.41 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|