C20H21NO2 — CID 118199582
N-(3,4-dimethylphenyl)-2,2-dimethylchromene-6-carboxamide (PubChem CID 118199582) has the molecular formula C20H21NO2 and a molecular weight of 307.39 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-2,2-dimethylchromene-6-carboxamide.
| Compound Name | N-(3,4-dimethylphenyl)-2,2-dimethylchromene-6-carboxamide |
|---|---|
| PubChem CID | 118199582 |
| Molecular Formula | C20H21NO2 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | N-(3,4-dimethylphenyl)-2,2-dimethylchromene-6-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2ccc3c(c2)C=CC(C)(C)O3)cc1C |
| InChI | InChI=1S/C20H21NO2/c1-13-5-7-17(11-14(13)2)21-19(22)16-6-8-18-15(12-16)9-10-20(3,4)23-18/h5-12H,1-4H3,(H,21,22) |
| InChIKey | BCXPGZYLKQKPKM-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |