C19H20N2O2 — CID 171487218
2,2-dimethyl-N'-(2-methylphenyl)chromene-6-carbohydrazide (PubChem CID 171487218) has the molecular formula C19H20N2O2 and a molecular weight of 308.38 g/mol. Its IUPAC name is 2,2-dimethyl-N'-(2-methylphenyl)chromene-6-carbohydrazide.
| Compound Name | 2,2-dimethyl-N'-(2-methylphenyl)chromene-6-carbohydrazide |
|---|---|
| PubChem CID | 171487218 |
| Molecular Formula | C19H20N2O2 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | 2,2-dimethyl-N'-(2-methylphenyl)chromene-6-carbohydrazide |
| SMILES | Cc1ccccc1NNC(=O)c1ccc2c(c1)C=CC(C)(C)O2 |
| InChI | InChI=1S/C19H20N2O2/c1-13-6-4-5-7-16(13)20-21-18(22)15-8-9-17-14(12-15)10-11-19(2,3)23-17/h4-12,20H,1-3H3,(H,21,22) |
| InChIKey | YZISAYOKJHCLPO-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|