C18H16F2N2O2 — CID 171487215
N'-(2,4-difluorophenyl)-2,2-dimethylchromene-6-carbohydrazide (PubChem CID 171487215) has the molecular formula C18H16F2N2O2 and a molecular weight of 330.33 g/mol. Its IUPAC name is N'-(2,4-difluorophenyl)-2,2-dimethylchromene-6-carbohydrazide.
| Compound Name | N'-(2,4-difluorophenyl)-2,2-dimethylchromene-6-carbohydrazide |
|---|---|
| PubChem CID | 171487215 |
| Molecular Formula | C18H16F2N2O2 |
| Molecular Weight | 330.33 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | N'-(2,4-difluorophenyl)-2,2-dimethylchromene-6-carbohydrazide |
| SMILES | CC1(C)C=Cc2cc(C(=O)NNc3ccc(F)cc3F)ccc2O1 |
| InChI | InChI=1S/C18H16F2N2O2/c1-18(2)8-7-11-9-12(3-6-16(11)24-18)17(23)22-21-15-5-4-13(19)10-14(15)20/h3-10,21H,1-2H3,(H,22,23) |
| InChIKey | JMJPGSMJGBMQDM-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.33 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|