C13H13F2N3O — CID 118209138
1-(2,4-difluorophenyl)-1,3,8-triazaspiro[4.5]dec-2-en-4-one (PubChem CID 118209138) has the molecular formula C13H13F2N3O and a molecular weight of 265.26 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-1,3,8-triazaspiro[4.5]dec-2-en-4-one.
| Compound Name | 1-(2,4-difluorophenyl)-1,3,8-triazaspiro[4.5]dec-2-en-4-one |
|---|---|
| PubChem CID | 118209138 |
| Molecular Formula | C13H13F2N3O |
| Molecular Weight | 265.26 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | 1-(2,4-difluorophenyl)-1,3,8-triazaspiro[4.5]dec-2-en-4-one |
| SMILES | O=C1N=CN(c2ccc(F)cc2F)C12CCNCC2 |
| InChI | InChI=1S/C13H13F2N3O/c14-9-1-2-11(10(15)7-9)18-8-17-12(19)13(18)3-5-16-6-4-13/h1-2,7-8,16H,3-6H2 |
| InChIKey | PYCUYJCPPQISOO-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.26 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |