About 5-cyclohexyl-3-(2,4-difluorophenyl)imidazolidine-2,4-dione
5-cyclohexyl-3-(2,4-difluorophenyl)imidazolidine-2,4-dione (PubChem CID 61016880) has the molecular formula C15H16F2N2O2
and a molecular weight of 294.30 g/mol. Its IUPAC name is 5-cyclohexyl-3-(2,4-difluorophenyl)imidazolidine-2,4-dione.
Molecular Properties
| Compound Name | 5-cyclohexyl-3-(2,4-difluorophenyl)imidazolidine-2,4-dione |
| PubChem CID | 61016880 |
| Molecular Formula | C15H16F2N2O2 |
| Molecular Weight | 294.30 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 5-cyclohexyl-3-(2,4-difluorophenyl)imidazolidine-2,4-dione |
| SMILES | O=C1NC(C2CCCCC2)C(=O)N1c1ccc(F)cc1F |
| InChI | InChI=1S/C15H16F2N2O2/c16-10-6-7-12(11(17)8-10)19-14(20)13(18-15(19)21)9-4-2-1-3-5-9/h6-9,13H,1-5H2,(H,18,21) |
| InChIKey | KUFUBMBZQJOIOD-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.30 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze 5-cyclohexyl-3-(2,4-difluorophenyl)imidazolidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyclohexyl-3-(2,4-difluorophenyl)imidazolidine-2,4-dione?
The IUPAC name of 5-cyclohexyl-3-(2,4-difluorophenyl)imidazolidine-2,4-dione (CID 61016880) is 5-cyclohexyl-3-(2,4-difluorophenyl)imidazolidine-2,4-dione.
What is the SMILES notation for 5-cyclohexyl-3-(2,4-difluorophenyl)imidazolidine-2,4-dione?
The canonical SMILES for 5-cyclohexyl-3-(2,4-difluorophenyl)imidazolidine-2,4-dione is O=C1NC(C2CCCCC2)C(=O)N1c1ccc(F)cc1F.
What is the InChIKey of 5-cyclohexyl-3-(2,4-difluorophenyl)imidazolidine-2,4-dione?
The InChIKey is KUFUBMBZQJOIOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16F2N2O2/c16-10-6-7-12(11(17)8-10)19-14(20)13(18-15(19)21)9-4-2-1-3-5-9/h6-9,13H,1-5H2,(H,18,21).
What are the key properties of 5-cyclohexyl-3-(2,4-difluorophenyl)imidazolidine-2,4-dione?
5-cyclohexyl-3-(2,4-difluorophenyl)imidazolidine-2,4-dione has a molecular weight of 294.30 g/mol, XLogP of 2.97, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclohexyl-3-(2,4-difluorophenyl)imidazolidine-2,4-dione is sourced from PubChem (CID 61016880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).