C14H14F2N2O — CID 98078163
(3aR)-2-(2,4-difluorophenyl)-3a,4,5,6,7,8-hexahydrocyclohepta[c]pyrazol-3-one (PubChem CID 98078163) has the molecular formula C14H14F2N2O and a molecular weight of 264.27 g/mol. Its IUPAC name is (3aR)-2-(2,4-difluorophenyl)-3a,4,5,6,7,8-hexahydrocyclohepta[c]pyrazol-3-one.
| Compound Name | (3aR)-2-(2,4-difluorophenyl)-3a,4,5,6,7,8-hexahydrocyclohepta[c]pyrazol-3-one |
|---|---|
| PubChem CID | 98078163 |
| Molecular Formula | C14H14F2N2O |
| Molecular Weight | 264.27 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | (3aR)-2-(2,4-difluorophenyl)-3a,4,5,6,7,8-hexahydrocyclohepta[c]pyrazol-3-one |
| SMILES | O=C1[C@@H]2CCCCCC2=NN1c1ccc(F)cc1F |
| InChI | InChI=1S/C14H14F2N2O/c15-9-6-7-13(11(16)8-9)18-14(19)10-4-2-1-3-5-12(10)17-18/h6-8,10H,1-5H2/t10-/m1/s1 |
| InChIKey | OHURIRKXBRXJQM-SNVBAGLBSA-N |
| XLogP | 3.25 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.27 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |