C25H23ClFN5O2 — CID 11820998
N-[(E)-(2-chlorophenyl)methylideneamino]-N-[2-[4-(4-fluorophenyl)piperazin-1-yl]-2-oxoethyl]pyridine-4-carboxamide (PubChem CID 11820998) has the molecular formula C25H23ClFN5O2 and a molecular weight of 479.94 g/mol. Its IUPAC name is N-[(E)-(2-chlorophenyl)methylideneamino]-N-[2-[4-(4-fluorophenyl)piperazin-1-yl]-2-oxoethyl]pyridine-4-carboxamide.
| Compound Name | N-[(E)-(2-chlorophenyl)methylideneamino]-N-[2-[4-(4-fluorophenyl)piperazin-1-yl]-2-oxoethyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 11820998 |
| Molecular Formula | C25H23ClFN5O2 |
| Molecular Weight | 479.94 g/mol |
| Exact Mass | 479.15 |
| IUPAC Name | N-[(E)-(2-chlorophenyl)methylideneamino]-N-[2-[4-(4-fluorophenyl)piperazin-1-yl]-2-oxoethyl]pyridine-4-carboxamide |
| SMILES | O=C(CN(/N=C/c1ccccc1Cl)C(=O)c1ccncc1)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C25H23ClFN5O2/c26-23-4-2-1-3-20(23)17-29-32(25(34)19-9-11-28-12-10-19)18-24(33)31-15-13-30(14-16-31)22-7-5-21(27)6-8-22/h1-12,17H,13-16,18H2/b29-17+ |
| InChIKey | RPQGRAJGQLQEFE-STBIYBPSSA-N |
| XLogP | 3.70 |
| TPSA | 69.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.94 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|